C15H12ClNO — CID 63511378
4-chloro-2-(2,3-dimethylphenoxy)benzonitrile (PubChem CID 63511378) has the molecular formula C15H12ClNO and a molecular weight of 257.72 g/mol. Its IUPAC name is 4-chloro-2-(2,3-dimethylphenoxy)benzonitrile.
| Compound Name | 4-chloro-2-(2,3-dimethylphenoxy)benzonitrile |
|---|---|
| PubChem CID | 63511378 |
| Molecular Formula | C15H12ClNO |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 4-chloro-2-(2,3-dimethylphenoxy)benzonitrile |
| SMILES | Cc1cccc(Oc2cc(Cl)ccc2C#N)c1C |
| InChI | InChI=1S/C15H12ClNO/c1-10-4-3-5-14(11(10)2)18-15-8-13(16)7-6-12(15)9-17/h3-8H,1-2H3 |
| InChIKey | FOCZCNIKEYSMQX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |