About 2-(2-chlorocyclohexyl)-1,4-dimethylbenzene
2-(2-chlorocyclohexyl)-1,4-dimethylbenzene (PubChem CID 63512125) has the molecular formula C14H19Cl
and a molecular weight of 222.76 g/mol. Its IUPAC name is 2-(2-chlorocyclohexyl)-1,4-dimethylbenzene.
Molecular Properties
| Compound Name | 2-(2-chlorocyclohexyl)-1,4-dimethylbenzene |
| PubChem CID | 63512125 |
| Molecular Formula | C14H19Cl |
| Molecular Weight | 222.76 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 2-(2-chlorocyclohexyl)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(C2CCCCC2Cl)c1 |
| InChI | InChI=1S/C14H19Cl/c1-10-7-8-11(2)13(9-10)12-5-3-4-6-14(12)15/h7-9,12,14H,3-6H2,1-2H3 |
| InChIKey | AXAISURVTVGSCX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.76 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chlorocyclohexyl)-1,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorocyclohexyl)-1,4-dimethylbenzene?
The IUPAC name of 2-(2-chlorocyclohexyl)-1,4-dimethylbenzene (CID 63512125) is 2-(2-chlorocyclohexyl)-1,4-dimethylbenzene.
What is the SMILES notation for 2-(2-chlorocyclohexyl)-1,4-dimethylbenzene?
The canonical SMILES for 2-(2-chlorocyclohexyl)-1,4-dimethylbenzene is Cc1ccc(C)c(C2CCCCC2Cl)c1.
What is the InChIKey of 2-(2-chlorocyclohexyl)-1,4-dimethylbenzene?
The InChIKey is AXAISURVTVGSCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19Cl/c1-10-7-8-11(2)13(9-10)12-5-3-4-6-14(12)15/h7-9,12,14H,3-6H2,1-2H3.
What are the key properties of 2-(2-chlorocyclohexyl)-1,4-dimethylbenzene?
2-(2-chlorocyclohexyl)-1,4-dimethylbenzene has a molecular weight of 222.76 g/mol, XLogP of 4.57, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorocyclohexyl)-1,4-dimethylbenzene is sourced from PubChem (CID 63512125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).