About 1-(2-bromocyclopentyl)-2,3-dichlorobenzene
1-(2-bromocyclopentyl)-2,3-dichlorobenzene (PubChem CID 63512300) has the molecular formula C11H11BrCl2
and a molecular weight of 294.02 g/mol. Its IUPAC name is 1-(2-bromocyclopentyl)-2,3-dichlorobenzene.
Molecular Properties
| Compound Name | 1-(2-bromocyclopentyl)-2,3-dichlorobenzene |
| PubChem CID | 63512300 |
| Molecular Formula | C11H11BrCl2 |
| Molecular Weight | 294.02 g/mol |
| Exact Mass | 291.94 |
| IUPAC Name | 1-(2-bromocyclopentyl)-2,3-dichlorobenzene |
| SMILES | Clc1cccc(C2CCCC2Br)c1Cl |
| InChI | InChI=1S/C11H11BrCl2/c12-9-5-1-3-7(9)8-4-2-6-10(13)11(8)14/h2,4,6-7,9H,1,3,5H2 |
| InChIKey | RHGMMIBFVKYWJD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.02 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bromocyclopentyl)-2,3-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromocyclopentyl)-2,3-dichlorobenzene?
The IUPAC name of 1-(2-bromocyclopentyl)-2,3-dichlorobenzene (CID 63512300) is 1-(2-bromocyclopentyl)-2,3-dichlorobenzene.
What is the SMILES notation for 1-(2-bromocyclopentyl)-2,3-dichlorobenzene?
The canonical SMILES for 1-(2-bromocyclopentyl)-2,3-dichlorobenzene is Clc1cccc(C2CCCC2Br)c1Cl.
What is the InChIKey of 1-(2-bromocyclopentyl)-2,3-dichlorobenzene?
The InChIKey is RHGMMIBFVKYWJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrCl2/c12-9-5-1-3-7(9)8-4-2-6-10(13)11(8)14/h2,4,6-7,9H,1,3,5H2.
What are the key properties of 1-(2-bromocyclopentyl)-2,3-dichlorobenzene?
1-(2-bromocyclopentyl)-2,3-dichlorobenzene has a molecular weight of 294.02 g/mol, XLogP of 5.02, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromocyclopentyl)-2,3-dichlorobenzene is sourced from PubChem (CID 63512300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).