C17H17ClO — CID 63512515
5-chloro-3-phenoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 63512515) has the molecular formula C17H17ClO and a molecular weight of 272.78 g/mol. Its IUPAC name is 5-chloro-3-phenoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | 5-chloro-3-phenoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 63512515 |
| Molecular Formula | C17H17ClO |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 5-chloro-3-phenoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | ClC1CCCCc2ccc(Oc3ccccc3)cc21 |
| InChI | InChI=1S/C17H17ClO/c18-17-9-5-4-6-13-10-11-15(12-16(13)17)19-14-7-2-1-3-8-14/h1-3,7-8,10-12,17H,4-6,9H2 |
| InChIKey | ZBKGHOSFKPBSEG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|