C14H7FI3NO — CID 63512820
4-fluoro-3-[(2,4,6-triiodophenoxy)methyl]benzonitrile (PubChem CID 63512820) has the molecular formula C14H7FI3NO and a molecular weight of 604.93 g/mol. Its IUPAC name is 4-fluoro-3-[(2,4,6-triiodophenoxy)methyl]benzonitrile.
| Compound Name | 4-fluoro-3-[(2,4,6-triiodophenoxy)methyl]benzonitrile |
|---|---|
| PubChem CID | 63512820 |
| Molecular Formula | C14H7FI3NO |
| Molecular Weight | 604.93 g/mol |
| Exact Mass | 604.76 |
| IUPAC Name | 4-fluoro-3-[(2,4,6-triiodophenoxy)methyl]benzonitrile |
| SMILES | N#Cc1ccc(F)c(COc2c(I)cc(I)cc2I)c1 |
| InChI | InChI=1S/C14H7FI3NO/c15-11-2-1-8(6-19)3-9(11)7-20-14-12(17)4-10(16)5-13(14)18/h1-5H,7H2 |
| InChIKey | VQYZWZHDPZTNSM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.93 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|