About 1-chloro-7-cyclohexyl-1,2,3,4-tetrahydronaphthalene
1-chloro-7-cyclohexyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 63512844) has the molecular formula C16H21Cl
and a molecular weight of 248.80 g/mol. Its IUPAC name is 1-chloro-7-cyclohexyl-1,2,3,4-tetrahydronaphthalene.
Molecular Properties
| Compound Name | 1-chloro-7-cyclohexyl-1,2,3,4-tetrahydronaphthalene |
| PubChem CID | 63512844 |
| Molecular Formula | C16H21Cl |
| Molecular Weight | 248.80 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-chloro-7-cyclohexyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | ClC1CCCc2ccc(C3CCCCC3)cc21 |
| InChI | InChI=1S/C16H21Cl/c17-16-8-4-7-13-9-10-14(11-15(13)16)12-5-2-1-3-6-12/h9-12,16H,1-8H2 |
| InChIKey | LCGBTPDDOFNGIE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.80 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-7-cyclohexyl-1,2,3,4-tetrahydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-7-cyclohexyl-1,2,3,4-tetrahydronaphthalene?
The IUPAC name of 1-chloro-7-cyclohexyl-1,2,3,4-tetrahydronaphthalene (CID 63512844) is 1-chloro-7-cyclohexyl-1,2,3,4-tetrahydronaphthalene.
What is the SMILES notation for 1-chloro-7-cyclohexyl-1,2,3,4-tetrahydronaphthalene?
The canonical SMILES for 1-chloro-7-cyclohexyl-1,2,3,4-tetrahydronaphthalene is ClC1CCCc2ccc(C3CCCCC3)cc21.
What is the InChIKey of 1-chloro-7-cyclohexyl-1,2,3,4-tetrahydronaphthalene?
The InChIKey is LCGBTPDDOFNGIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21Cl/c17-16-8-4-7-13-9-10-14(11-15(13)16)12-5-2-1-3-6-12/h9-12,16H,1-8H2.
What are the key properties of 1-chloro-7-cyclohexyl-1,2,3,4-tetrahydronaphthalene?
1-chloro-7-cyclohexyl-1,2,3,4-tetrahydronaphthalene has a molecular weight of 248.80 g/mol, XLogP of 5.35, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-7-cyclohexyl-1,2,3,4-tetrahydronaphthalene is sourced from PubChem (CID 63512844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).