C16H23Br — CID 63514075
5-bromo-3-tert-butyl-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 63514075) has the molecular formula C16H23Br and a molecular weight of 295.26 g/mol. Its IUPAC name is 5-bromo-3-tert-butyl-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | 5-bromo-3-tert-butyl-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 63514075 |
| Molecular Formula | C16H23Br |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-bromo-3-tert-butyl-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | CC1CCc2ccc(C(C)(C)C)cc2C(Br)C1 |
| InChI | InChI=1S/C16H23Br/c1-11-5-6-12-7-8-13(16(2,3)4)10-14(12)15(17)9-11/h7-8,10-11,15H,5-6,9H2,1-4H3 |
| InChIKey | IIKVGPXBVCUNJK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|