About 2-(4-chloro-3,5-dimethylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile
2-(4-chloro-3,5-dimethylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile (PubChem CID 63514485) has the molecular formula C17H15ClN2O
and a molecular weight of 298.77 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile |
| PubChem CID | 63514485 |
| Molecular Formula | C17H15ClN2O |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile |
| SMILES | Cc1cc(Oc2nc3c(cc2C#N)CCC3)cc(C)c1Cl |
| InChI | InChI=1S/C17H15ClN2O/c1-10-6-14(7-11(2)16(10)18)21-17-13(9-19)8-12-4-3-5-15(12)20-17/h6-8H,3-5H2,1-2H3 |
| InChIKey | VOKFDTYGSXFCNH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-chloro-3,5-dimethylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-3,5-dimethylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile?
The IUPAC name of 2-(4-chloro-3,5-dimethylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile (CID 63514485) is 2-(4-chloro-3,5-dimethylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile.
What is the SMILES notation for 2-(4-chloro-3,5-dimethylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile?
The canonical SMILES for 2-(4-chloro-3,5-dimethylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile is Cc1cc(Oc2nc3c(cc2C#N)CCC3)cc(C)c1Cl.
What is the InChIKey of 2-(4-chloro-3,5-dimethylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile?
The InChIKey is VOKFDTYGSXFCNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN2O/c1-10-6-14(7-11(2)16(10)18)21-17-13(9-19)8-12-4-3-5-15(12)20-17/h6-8H,3-5H2,1-2H3.
What are the key properties of 2-(4-chloro-3,5-dimethylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile?
2-(4-chloro-3,5-dimethylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile has a molecular weight of 298.77 g/mol, XLogP of 4.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-3,5-dimethylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile is sourced from PubChem (CID 63514485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).