C15H10I3NO2 — CID 63514562
3-[2-(2,4,6-triiodophenoxy)ethoxy]benzonitrile (PubChem CID 63514562) has the molecular formula C15H10I3NO2 and a molecular weight of 616.96 g/mol. Its IUPAC name is 3-[2-(2,4,6-triiodophenoxy)ethoxy]benzonitrile.
| Compound Name | 3-[2-(2,4,6-triiodophenoxy)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 63514562 |
| Molecular Formula | C15H10I3NO2 |
| Molecular Weight | 616.96 g/mol |
| Exact Mass | 616.78 |
| IUPAC Name | 3-[2-(2,4,6-triiodophenoxy)ethoxy]benzonitrile |
| SMILES | N#Cc1cccc(OCCOc2c(I)cc(I)cc2I)c1 |
| InChI | InChI=1S/C15H10I3NO2/c16-11-7-13(17)15(14(18)8-11)21-5-4-20-12-3-1-2-10(6-12)9-19/h1-3,6-8H,4-5H2 |
| InChIKey | PPHIHCFDHCIYAY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.96 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|