C16H21BrO2 — CID 63514604
12-bromo-14,14-dimethyl-4,8-dioxatricyclo[9.5.0.03,9]hexadeca-1,3(9),10-triene (PubChem CID 63514604) has the molecular formula C16H21BrO2 and a molecular weight of 325.25 g/mol. Its IUPAC name is 12-bromo-14,14-dimethyl-4,8-dioxatricyclo[9.5.0.03,9]hexadeca-1,3(9),10-triene.
| Compound Name | 12-bromo-14,14-dimethyl-4,8-dioxatricyclo[9.5.0.03,9]hexadeca-1,3(9),10-triene |
|---|---|
| PubChem CID | 63514604 |
| Molecular Formula | C16H21BrO2 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 12-bromo-14,14-dimethyl-4,8-dioxatricyclo[9.5.0.03,9]hexadeca-1,3(9),10-triene |
| SMILES | CC1(C)CCc2cc3c(cc2C(Br)C1)OCCCO3 |
| InChI | InChI=1S/C16H21BrO2/c1-16(2)5-4-11-8-14-15(19-7-3-6-18-14)9-12(11)13(17)10-16/h8-9,13H,3-7,10H2,1-2H3 |
| InChIKey | LJRWEGPVVRDBSJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|