C11H22N4OS — CID 63515498
N-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-ethoxypropan-1-amine (PubChem CID 63515498) has the molecular formula C11H22N4OS and a molecular weight of 258.39 g/mol. Its IUPAC name is N-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-ethoxypropan-1-amine.
| Compound Name | N-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-ethoxypropan-1-amine |
|---|---|
| PubChem CID | 63515498 |
| Molecular Formula | C11H22N4OS |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-ethoxypropan-1-amine |
| SMILES | CCOCCCNCCSc1nnc(C)n1C |
| InChI | InChI=1S/C11H22N4OS/c1-4-16-8-5-6-12-7-9-17-11-14-13-10(2)15(11)3/h12H,4-9H2,1-3H3 |
| InChIKey | TXFVJQGVWIXUOK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|