C18H31NO — CID 63515562
3,3-dimethyl-N-[2-(3-methyl-5-propan-2-ylphenoxy)ethyl]butan-1-amine (PubChem CID 63515562) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 3,3-dimethyl-N-[2-(3-methyl-5-propan-2-ylphenoxy)ethyl]butan-1-amine.
| Compound Name | 3,3-dimethyl-N-[2-(3-methyl-5-propan-2-ylphenoxy)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 63515562 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 3,3-dimethyl-N-[2-(3-methyl-5-propan-2-ylphenoxy)ethyl]butan-1-amine |
| SMILES | Cc1cc(OCCNCCC(C)(C)C)cc(C(C)C)c1 |
| InChI | InChI=1S/C18H31NO/c1-14(2)16-11-15(3)12-17(13-16)20-10-9-19-8-7-18(4,5)6/h11-14,19H,7-10H2,1-6H3 |
| InChIKey | KKMXTJQNIXQCOX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|