C12H14Cl5NO2 — CID 63515565
1-methoxy-N-[2-(2,3,4,5,6-pentachlorophenoxy)ethyl]propan-2-amine (PubChem CID 63515565) has the molecular formula C12H14Cl5NO2 and a molecular weight of 381.51 g/mol. Its IUPAC name is 1-methoxy-N-[2-(2,3,4,5,6-pentachlorophenoxy)ethyl]propan-2-amine.
| Compound Name | 1-methoxy-N-[2-(2,3,4,5,6-pentachlorophenoxy)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 63515565 |
| Molecular Formula | C12H14Cl5NO2 |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | 1-methoxy-N-[2-(2,3,4,5,6-pentachlorophenoxy)ethyl]propan-2-amine |
| SMILES | COCC(C)NCCOc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H14Cl5NO2/c1-6(5-19-2)18-3-4-20-12-10(16)8(14)7(13)9(15)11(12)17/h6,18H,3-5H2,1-2H3 |
| InChIKey | BRZUSTKWCKAGIY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|