C16H21F3O — CID 63520008
1-cyclohexyl-3-[4-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 63520008) has the molecular formula C16H21F3O and a molecular weight of 286.34 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | 1-cyclohexyl-3-[4-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 63520008 |
| Molecular Formula | C16H21F3O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-cyclohexyl-3-[4-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | OC(Cc1ccc(C(F)(F)F)cc1)CC1CCCCC1 |
| InChI | InChI=1S/C16H21F3O/c17-16(18,19)14-8-6-13(7-9-14)11-15(20)10-12-4-2-1-3-5-12/h6-9,12,15,20H,1-5,10-11H2 |
| InChIKey | SYMSIYTXDQCIBU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |