C20H41N — CID 63521313
N-[[4-butyl-1-(3-methylbutyl)cyclohexyl]methyl]-2-methylpropan-2-amine (PubChem CID 63521313) has the molecular formula C20H41N and a molecular weight of 295.56 g/mol. Its IUPAC name is N-[[4-butyl-1-(3-methylbutyl)cyclohexyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[4-butyl-1-(3-methylbutyl)cyclohexyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 63521313 |
| Molecular Formula | C20H41N |
| Molecular Weight | 295.56 g/mol |
| Exact Mass | 295.32 |
| IUPAC Name | N-[[4-butyl-1-(3-methylbutyl)cyclohexyl]methyl]-2-methylpropan-2-amine |
| SMILES | CCCCC1CCC(CCC(C)C)(CNC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H41N/c1-7-8-9-18-11-14-20(15-12-18,13-10-17(2)3)16-21-19(4,5)6/h17-18,21H,7-16H2,1-6H3 |
| InChIKey | PWGMPMAUHREQGO-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |