C15H17BrClNS — CID 63521745
2-[(3-bromophenyl)methyl]-3-(5-chlorothiophen-2-yl)-N-methylpropan-1-amine (PubChem CID 63521745) has the molecular formula C15H17BrClNS and a molecular weight of 358.73 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-3-(5-chlorothiophen-2-yl)-N-methylpropan-1-amine.
| Compound Name | 2-[(3-bromophenyl)methyl]-3-(5-chlorothiophen-2-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 63521745 |
| Molecular Formula | C15H17BrClNS |
| Molecular Weight | 358.73 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-3-(5-chlorothiophen-2-yl)-N-methylpropan-1-amine |
| SMILES | CNCC(Cc1cccc(Br)c1)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C15H17BrClNS/c1-18-10-12(9-14-5-6-15(17)19-14)7-11-3-2-4-13(16)8-11/h2-6,8,12,18H,7,9-10H2,1H3 |
| InChIKey | GAQUPGPPVDNIQK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.73 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |