C13H6BrFI3NO — CID 63524397
2-bromo-5-fluoro-N-(2,4,6-triiodophenyl)benzamide (PubChem CID 63524397) has the molecular formula C13H6BrFI3NO and a molecular weight of 671.81 g/mol. Its IUPAC name is 2-bromo-5-fluoro-N-(2,4,6-triiodophenyl)benzamide.
| Compound Name | 2-bromo-5-fluoro-N-(2,4,6-triiodophenyl)benzamide |
|---|---|
| PubChem CID | 63524397 |
| Molecular Formula | C13H6BrFI3NO |
| Molecular Weight | 671.81 g/mol |
| Exact Mass | 670.68 |
| IUPAC Name | 2-bromo-5-fluoro-N-(2,4,6-triiodophenyl)benzamide |
| SMILES | O=C(Nc1c(I)cc(I)cc1I)c1cc(F)ccc1Br |
| InChI | InChI=1S/C13H6BrFI3NO/c14-9-2-1-6(15)3-8(9)13(20)19-12-10(17)4-7(16)5-11(12)18/h1-5H,(H,19,20) |
| InChIKey | AMBBJRUXXOSQCE-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.81 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|