C16H13Cl2N3 — CID 63525572
4-(3,4-dichlorophenyl)-5-(4-methylphenyl)-1H-pyrazol-3-amine (PubChem CID 63525572) has the molecular formula C16H13Cl2N3 and a molecular weight of 318.21 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-5-(4-methylphenyl)-1H-pyrazol-3-amine.
| Compound Name | 4-(3,4-dichlorophenyl)-5-(4-methylphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 63525572 |
| Molecular Formula | C16H13Cl2N3 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-5-(4-methylphenyl)-1H-pyrazol-3-amine |
| SMILES | Cc1ccc(-c2[nH]nc(N)c2-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H13Cl2N3/c1-9-2-4-10(5-3-9)15-14(16(19)21-20-15)11-6-7-12(17)13(18)8-11/h2-8H,1H3,(H3,19,20,21) |
| InChIKey | YMICYYWDLRFJGO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |