C13H14BrClN2 — CID 63525765
6-bromo-8-chloro-N,3-diethylquinolin-2-amine (PubChem CID 63525765) has the molecular formula C13H14BrClN2 and a molecular weight of 313.63 g/mol. Its IUPAC name is 6-bromo-8-chloro-N,3-diethylquinolin-2-amine.
| Compound Name | 6-bromo-8-chloro-N,3-diethylquinolin-2-amine |
|---|---|
| PubChem CID | 63525765 |
| Molecular Formula | C13H14BrClN2 |
| Molecular Weight | 313.63 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 6-bromo-8-chloro-N,3-diethylquinolin-2-amine |
| SMILES | CCNc1nc2c(Cl)cc(Br)cc2cc1CC |
| InChI | InChI=1S/C13H14BrClN2/c1-3-8-5-9-6-10(14)7-11(15)12(9)17-13(8)16-4-2/h5-7H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | RYLRBOWYNIQERU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |