C17H16ClNS — CID 63527021
1-(1-benzothiophen-2-yl)-2-(2-chlorophenyl)-N-methylethanamine (PubChem CID 63527021) has the molecular formula C17H16ClNS and a molecular weight of 301.84 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-2-(2-chlorophenyl)-N-methylethanamine.
| Compound Name | 1-(1-benzothiophen-2-yl)-2-(2-chlorophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 63527021 |
| Molecular Formula | C17H16ClNS |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-2-(2-chlorophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccccc1Cl)c1cc2ccccc2s1 |
| InChI | InChI=1S/C17H16ClNS/c1-19-15(10-12-6-2-4-8-14(12)18)17-11-13-7-3-5-9-16(13)20-17/h2-9,11,15,19H,10H2,1H3 |
| InChIKey | DFMSVZGNIABNOZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |