C18H22ClN — CID 63527888
1-(2-chlorophenyl)-N-methyl-4-(3-methylphenyl)butan-2-amine (PubChem CID 63527888) has the molecular formula C18H22ClN and a molecular weight of 287.83 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-methyl-4-(3-methylphenyl)butan-2-amine.
| Compound Name | 1-(2-chlorophenyl)-N-methyl-4-(3-methylphenyl)butan-2-amine |
|---|---|
| PubChem CID | 63527888 |
| Molecular Formula | C18H22ClN |
| Molecular Weight | 287.83 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1-(2-chlorophenyl)-N-methyl-4-(3-methylphenyl)butan-2-amine |
| SMILES | CNC(CCc1cccc(C)c1)Cc1ccccc1Cl |
| InChI | InChI=1S/C18H22ClN/c1-14-6-5-7-15(12-14)10-11-17(20-2)13-16-8-3-4-9-18(16)19/h3-9,12,17,20H,10-11,13H2,1-2H3 |
| InChIKey | ZSHPXTWRVGYXML-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.83 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |