C19H42N2 — CID 63528013
N'-dodecyl-N'-ethyl-N-propan-2-ylethane-1,2-diamine (PubChem CID 63528013) has the molecular formula C19H42N2 and a molecular weight of 298.56 g/mol. Its IUPAC name is N'-dodecyl-N'-ethyl-N-propan-2-ylethane-1,2-diamine.
| Compound Name | N'-dodecyl-N'-ethyl-N-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 63528013 |
| Molecular Formula | C19H42N2 |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.33 |
| IUPAC Name | N'-dodecyl-N'-ethyl-N-propan-2-ylethane-1,2-diamine |
| SMILES | CCCCCCCCCCCCN(CC)CCNC(C)C |
| InChI | InChI=1S/C19H42N2/c1-5-7-8-9-10-11-12-13-14-15-17-21(6-2)18-16-20-19(3)4/h19-20H,5-18H2,1-4H3 |
| InChIKey | GTBVDPKOQCXNPM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|