C18H21BrFN — CID 63528107
N-[1-(2-bromo-4-fluorophenyl)-2-(2-methylphenyl)ethyl]propan-1-amine (PubChem CID 63528107) has the molecular formula C18H21BrFN and a molecular weight of 350.28 g/mol. Its IUPAC name is N-[1-(2-bromo-4-fluorophenyl)-2-(2-methylphenyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(2-bromo-4-fluorophenyl)-2-(2-methylphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 63528107 |
| Molecular Formula | C18H21BrFN |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | N-[1-(2-bromo-4-fluorophenyl)-2-(2-methylphenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccccc1C)c1ccc(F)cc1Br |
| InChI | InChI=1S/C18H21BrFN/c1-3-10-21-18(11-14-7-5-4-6-13(14)2)16-9-8-15(20)12-17(16)19/h4-9,12,18,21H,3,10-11H2,1-2H3 |
| InChIKey | QNNPLTVEKRMMOG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |