C18H21ClFN — CID 63528128
N-[1-(2-chloro-6-fluorophenyl)-2-(3-methylphenyl)ethyl]propan-1-amine (PubChem CID 63528128) has the molecular formula C18H21ClFN and a molecular weight of 305.82 g/mol. Its IUPAC name is N-[1-(2-chloro-6-fluorophenyl)-2-(3-methylphenyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(2-chloro-6-fluorophenyl)-2-(3-methylphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 63528128 |
| Molecular Formula | C18H21ClFN |
| Molecular Weight | 305.82 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-[1-(2-chloro-6-fluorophenyl)-2-(3-methylphenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cccc(C)c1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C18H21ClFN/c1-3-10-21-17(12-14-7-4-6-13(2)11-14)18-15(19)8-5-9-16(18)20/h4-9,11,17,21H,3,10,12H2,1-2H3 |
| InChIKey | AYYKYSLPERJSSO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.82 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |