C17H23BrO2S — CID 63529485
2-(4-bromophenyl)sulfanyl-4-tert-butylcyclohexane-1-carboxylic acid (PubChem CID 63529485) has the molecular formula C17H23BrO2S and a molecular weight of 371.34 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-4-tert-butylcyclohexane-1-carboxylic acid.
| Compound Name | 2-(4-bromophenyl)sulfanyl-4-tert-butylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63529485 |
| Molecular Formula | C17H23BrO2S |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-4-tert-butylcyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)C1CCC(C(=O)O)C(Sc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C17H23BrO2S/c1-17(2,3)11-4-9-14(16(19)20)15(10-11)21-13-7-5-12(18)6-8-13/h5-8,11,14-15H,4,9-10H2,1-3H3,(H,19,20) |
| InChIKey | QWTNJLUCLFGLFN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |