C16H21ClO2S — CID 63529638
2-(4-chlorophenyl)sulfanyl-4-propylcyclohexane-1-carboxylic acid (PubChem CID 63529638) has the molecular formula C16H21ClO2S and a molecular weight of 312.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-4-propylcyclohexane-1-carboxylic acid.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-4-propylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63529638 |
| Molecular Formula | C16H21ClO2S |
| Molecular Weight | 312.86 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-4-propylcyclohexane-1-carboxylic acid |
| SMILES | CCCC1CCC(C(=O)O)C(Sc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H21ClO2S/c1-2-3-11-4-9-14(16(18)19)15(10-11)20-13-7-5-12(17)6-8-13/h5-8,11,14-15H,2-4,9-10H2,1H3,(H,18,19) |
| InChIKey | WRTKLNJYJWBYAE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.86 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |