C15H16BrClN2O2 — CID 63530544
6-bromo-4-(2-chloro-3,3-dimethylbutyl)-3-nitroquinoline (PubChem CID 63530544) has the molecular formula C15H16BrClN2O2 and a molecular weight of 371.66 g/mol. Its IUPAC name is 6-bromo-4-(2-chloro-3,3-dimethylbutyl)-3-nitroquinoline.
| Compound Name | 6-bromo-4-(2-chloro-3,3-dimethylbutyl)-3-nitroquinoline |
|---|---|
| PubChem CID | 63530544 |
| Molecular Formula | C15H16BrClN2O2 |
| Molecular Weight | 371.66 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 6-bromo-4-(2-chloro-3,3-dimethylbutyl)-3-nitroquinoline |
| SMILES | CC(C)(C)C(Cl)Cc1c([N+](=O)[O-])cnc2ccc(Br)cc12 |
| InChI | InChI=1S/C15H16BrClN2O2/c1-15(2,3)14(17)7-11-10-6-9(16)4-5-12(10)18-8-13(11)19(20)21/h4-6,8,14H,7H2,1-3H3 |
| InChIKey | YFMRKGWPMRFSQT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|