C18H30N2 — CID 63532343
N,3,5-trimethyl-N-[(4-propylpiperidin-4-yl)methyl]aniline (PubChem CID 63532343) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is N,3,5-trimethyl-N-[(4-propylpiperidin-4-yl)methyl]aniline.
| Compound Name | N,3,5-trimethyl-N-[(4-propylpiperidin-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 63532343 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | N,3,5-trimethyl-N-[(4-propylpiperidin-4-yl)methyl]aniline |
| SMILES | CCCC1(CN(C)c2cc(C)cc(C)c2)CCNCC1 |
| InChI | InChI=1S/C18H30N2/c1-5-6-18(7-9-19-10-8-18)14-20(4)17-12-15(2)11-16(3)13-17/h11-13,19H,5-10,14H2,1-4H3 |
| InChIKey | BGYBTGTWLHVCBT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |