C18H31ClN2 — CID 63533144
2-chloro-N-(2-methylpropyl)-N-propan-2-yl-4-[1-(propylamino)ethyl]aniline (PubChem CID 63533144) has the molecular formula C18H31ClN2 and a molecular weight of 310.91 g/mol. Its IUPAC name is 2-chloro-N-(2-methylpropyl)-N-propan-2-yl-4-[1-(propylamino)ethyl]aniline.
| Compound Name | 2-chloro-N-(2-methylpropyl)-N-propan-2-yl-4-[1-(propylamino)ethyl]aniline |
|---|---|
| PubChem CID | 63533144 |
| Molecular Formula | C18H31ClN2 |
| Molecular Weight | 310.91 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 2-chloro-N-(2-methylpropyl)-N-propan-2-yl-4-[1-(propylamino)ethyl]aniline |
| SMILES | CCCNC(C)c1ccc(N(CC(C)C)C(C)C)c(Cl)c1 |
| InChI | InChI=1S/C18H31ClN2/c1-7-10-20-15(6)16-8-9-18(17(19)11-16)21(14(4)5)12-13(2)3/h8-9,11,13-15,20H,7,10,12H2,1-6H3 |
| InChIKey | LOMPOHWXYNZURJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.91 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|