C18H22ClNO — CID 63533466
N-[1-[3-chloro-4-(4-methylphenoxy)phenyl]ethyl]propan-1-amine (PubChem CID 63533466) has the molecular formula C18H22ClNO and a molecular weight of 303.83 g/mol. Its IUPAC name is N-[1-[3-chloro-4-(4-methylphenoxy)phenyl]ethyl]propan-1-amine.
| Compound Name | N-[1-[3-chloro-4-(4-methylphenoxy)phenyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 63533466 |
| Molecular Formula | C18H22ClNO |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-[1-[3-chloro-4-(4-methylphenoxy)phenyl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1ccc(Oc2ccc(C)cc2)c(Cl)c1 |
| InChI | InChI=1S/C18H22ClNO/c1-4-11-20-14(3)15-7-10-18(17(19)12-15)21-16-8-5-13(2)6-9-16/h5-10,12,14,20H,4,11H2,1-3H3 |
| InChIKey | ZTQGHHFBDKYKAZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |