C17H17ClO2 — CID 63533846
1-[3-chloro-4-(2,3,5-trimethylphenoxy)phenyl]ethanone (PubChem CID 63533846) has the molecular formula C17H17ClO2 and a molecular weight of 288.77 g/mol. Its IUPAC name is 1-[3-chloro-4-(2,3,5-trimethylphenoxy)phenyl]ethanone.
| Compound Name | 1-[3-chloro-4-(2,3,5-trimethylphenoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 63533846 |
| Molecular Formula | C17H17ClO2 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-[3-chloro-4-(2,3,5-trimethylphenoxy)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Oc2cc(C)cc(C)c2C)c(Cl)c1 |
| InChI | InChI=1S/C17H17ClO2/c1-10-7-11(2)12(3)17(8-10)20-16-6-5-14(13(4)19)9-15(16)18/h5-9H,1-4H3 |
| InChIKey | MTQILMJQQFBTAS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |