About 1,3-dibromo-5-(3,5-dibromophenyl)benzene
1,3-dibromo-5-(3,5-dibromophenyl)benzene (PubChem CID 635340) has the molecular formula C12H6Br4
and a molecular weight of 469.80 g/mol. Its IUPAC name is 1,3-dibromo-5-(3,5-dibromophenyl)benzene.
Molecular Properties
| Compound Name | 1,3-dibromo-5-(3,5-dibromophenyl)benzene |
| PubChem CID | 635340 |
| Molecular Formula | C12H6Br4 |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 465.72 |
| IUPAC Name | 1,3-dibromo-5-(3,5-dibromophenyl)benzene |
| SMILES | Brc1cc(Br)cc(-c2cc(Br)cc(Br)c2)c1 |
| InChI | InChI=1S/C12H6Br4/c13-9-1-7(2-10(14)5-9)8-3-11(15)6-12(16)4-8/h1-6H |
| InChIKey | FXJXZYWFJAXIJX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-dibromo-5-(3,5-dibromophenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromo-5-(3,5-dibromophenyl)benzene?
The IUPAC name of 1,3-dibromo-5-(3,5-dibromophenyl)benzene (CID 635340) is 1,3-dibromo-5-(3,5-dibromophenyl)benzene.
What is the SMILES notation for 1,3-dibromo-5-(3,5-dibromophenyl)benzene?
The canonical SMILES for 1,3-dibromo-5-(3,5-dibromophenyl)benzene is Brc1cc(Br)cc(-c2cc(Br)cc(Br)c2)c1.
What is the InChIKey of 1,3-dibromo-5-(3,5-dibromophenyl)benzene?
The InChIKey is FXJXZYWFJAXIJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Br4/c13-9-1-7(2-10(14)5-9)8-3-11(15)6-12(16)4-8/h1-6H.
What are the key properties of 1,3-dibromo-5-(3,5-dibromophenyl)benzene?
1,3-dibromo-5-(3,5-dibromophenyl)benzene has a molecular weight of 469.80 g/mol, XLogP of 6.40, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromo-5-(3,5-dibromophenyl)benzene is sourced from PubChem (CID 635340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).