About 5-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid
5-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid (PubChem CID 63535830) has the molecular formula C17H16FNO2
and a molecular weight of 285.32 g/mol. Its IUPAC name is 5-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid.
Molecular Properties
| Compound Name | 5-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid |
| PubChem CID | 63535830 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 5-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid |
| SMILES | CC1Cc2ccccc2N(c2ccc(F)cc2C(=O)O)C1 |
| InChI | InChI=1S/C17H16FNO2/c1-11-8-12-4-2-3-5-15(12)19(10-11)16-7-6-13(18)9-14(16)17(20)21/h2-7,9,11H,8,10H2,1H3,(H,20,21) |
| InChIKey | YKXOHHZLOWLYSU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid?
The IUPAC name of 5-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid (CID 63535830) is 5-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid.
What is the SMILES notation for 5-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid?
The canonical SMILES for 5-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid is CC1Cc2ccccc2N(c2ccc(F)cc2C(=O)O)C1.
What is the InChIKey of 5-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid?
The InChIKey is YKXOHHZLOWLYSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FNO2/c1-11-8-12-4-2-3-5-15(12)19(10-11)16-7-6-13(18)9-14(16)17(20)21/h2-7,9,11H,8,10H2,1H3,(H,20,21).
What are the key properties of 5-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid?
5-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid has a molecular weight of 285.32 g/mol, XLogP of 3.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid is sourced from PubChem (CID 63535830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).