C33H60OSi — CID 635359
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-triethylsilane (PubChem CID 635359) has the molecular formula C33H60OSi and a molecular weight of 500.93 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-triethylsilane.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 635359 |
| Molecular Formula | C33H60OSi |
| Molecular Weight | 500.93 g/mol |
| Exact Mass | 500.44 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C33H60OSi/c1-9-35(10-2,11-3)34-27-19-21-32(7)26(23-27)15-16-28-30-18-17-29(25(6)14-12-13-24(4)5)33(30,8)22-20-31(28)32/h15,24-25,27-31H,9-14,16-23H2,1-8H3 |
| InChIKey | FPNWNZGAQJAPFH-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.93 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|