C13H23N3O4 — CID 63536519
5-[[3-(dimethylamino)pyrrolidine-1-carbonyl]amino]-3-methyl-5-oxopentanoic acid (PubChem CID 63536519) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is 5-[[3-(dimethylamino)pyrrolidine-1-carbonyl]amino]-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-[[3-(dimethylamino)pyrrolidine-1-carbonyl]amino]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 63536519 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 5-[[3-(dimethylamino)pyrrolidine-1-carbonyl]amino]-3-methyl-5-oxopentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)NC(=O)N1CCC(N(C)C)C1 |
| InChI | InChI=1S/C13H23N3O4/c1-9(7-12(18)19)6-11(17)14-13(20)16-5-4-10(8-16)15(2)3/h9-10H,4-8H2,1-3H3,(H,18,19)(H,14,17,20) |
| InChIKey | HYFNWROYHUDGSK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |