C15H14Cl2N2O2 — CID 63537031
5-chloro-6-[1-(3-chlorophenyl)ethyl-methylamino]pyridine-3-carboxylic acid (PubChem CID 63537031) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.20 g/mol. Its IUPAC name is 5-chloro-6-[1-(3-chlorophenyl)ethyl-methylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-6-[1-(3-chlorophenyl)ethyl-methylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63537031 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 5-chloro-6-[1-(3-chlorophenyl)ethyl-methylamino]pyridine-3-carboxylic acid |
| SMILES | CC(c1cccc(Cl)c1)N(C)c1ncc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C15H14Cl2N2O2/c1-9(10-4-3-5-12(16)6-10)19(2)14-13(17)7-11(8-18-14)15(20)21/h3-9H,1-2H3,(H,20,21) |
| InChIKey | UTBKOGAIPFJBFM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |