C12H16N6S — CID 63537457
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-4,6-dimethylpyridine-3-carboximidamide (PubChem CID 63537457) has the molecular formula C12H16N6S and a molecular weight of 276.37 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-4,6-dimethylpyridine-3-carboximidamide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-4,6-dimethylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 63537457 |
| Molecular Formula | C12H16N6S |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-4,6-dimethylpyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)cc(C)nc1Sc1nnc(C)n1C |
| InChI | InChI=1S/C12H16N6S/c1-6-5-7(2)15-11(9(6)10(13)14)19-12-17-16-8(3)18(12)4/h5H,1-4H3,(H3,13,14) |
| InChIKey | ZMDJHYMEYWBIND-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|