About 4-(2,5-dichlorophenyl)sulfanyl-5,5-dimethylhexan-3-amine
4-(2,5-dichlorophenyl)sulfanyl-5,5-dimethylhexan-3-amine (PubChem CID 63537566) has the molecular formula C14H21Cl2NS
and a molecular weight of 306.30 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)sulfanyl-5,5-dimethylhexan-3-amine.
Molecular Properties
| Compound Name | 4-(2,5-dichlorophenyl)sulfanyl-5,5-dimethylhexan-3-amine |
| PubChem CID | 63537566 |
| Molecular Formula | C14H21Cl2NS |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-(2,5-dichlorophenyl)sulfanyl-5,5-dimethylhexan-3-amine |
| SMILES | CCC(N)C(Sc1cc(Cl)ccc1Cl)C(C)(C)C |
| InChI | InChI=1S/C14H21Cl2NS/c1-5-11(17)13(14(2,3)4)18-12-8-9(15)6-7-10(12)16/h6-8,11,13H,5,17H2,1-4H3 |
| InChIKey | JADJSKYIFOWACD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,5-dichlorophenyl)sulfanyl-5,5-dimethylhexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dichlorophenyl)sulfanyl-5,5-dimethylhexan-3-amine?
The IUPAC name of 4-(2,5-dichlorophenyl)sulfanyl-5,5-dimethylhexan-3-amine (CID 63537566) is 4-(2,5-dichlorophenyl)sulfanyl-5,5-dimethylhexan-3-amine.
What is the SMILES notation for 4-(2,5-dichlorophenyl)sulfanyl-5,5-dimethylhexan-3-amine?
The canonical SMILES for 4-(2,5-dichlorophenyl)sulfanyl-5,5-dimethylhexan-3-amine is CCC(N)C(Sc1cc(Cl)ccc1Cl)C(C)(C)C.
What is the InChIKey of 4-(2,5-dichlorophenyl)sulfanyl-5,5-dimethylhexan-3-amine?
The InChIKey is JADJSKYIFOWACD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21Cl2NS/c1-5-11(17)13(14(2,3)4)18-12-8-9(15)6-7-10(12)16/h6-8,11,13H,5,17H2,1-4H3.
What are the key properties of 4-(2,5-dichlorophenyl)sulfanyl-5,5-dimethylhexan-3-amine?
4-(2,5-dichlorophenyl)sulfanyl-5,5-dimethylhexan-3-amine has a molecular weight of 306.30 g/mol, XLogP of 5.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dichlorophenyl)sulfanyl-5,5-dimethylhexan-3-amine is sourced from PubChem (CID 63537566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).