C10H20N4OS — CID 63537621
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol (PubChem CID 63537621) has the molecular formula C10H20N4OS and a molecular weight of 244.36 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol |
|---|---|
| PubChem CID | 63537621 |
| Molecular Formula | C10H20N4OS |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol |
| SMILES | CCCNCC(O)CSc1nnc(C)n1C |
| InChI | InChI=1S/C10H20N4OS/c1-4-5-11-6-9(15)7-16-10-13-12-8(2)14(10)3/h9,11,15H,4-7H2,1-3H3 |
| InChIKey | HRKAQNNPLZBRSD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|