C16H24ClNS — CID 63538085
1-(3-chlorophenyl)-1-cyclohexylsulfanylbutan-2-amine (PubChem CID 63538085) has the molecular formula C16H24ClNS and a molecular weight of 297.89 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-1-cyclohexylsulfanylbutan-2-amine.
| Compound Name | 1-(3-chlorophenyl)-1-cyclohexylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 63538085 |
| Molecular Formula | C16H24ClNS |
| Molecular Weight | 297.89 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-(3-chlorophenyl)-1-cyclohexylsulfanylbutan-2-amine |
| SMILES | CCC(N)C(SC1CCCCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H24ClNS/c1-2-15(18)16(12-7-6-8-13(17)11-12)19-14-9-4-3-5-10-14/h6-8,11,14-16H,2-5,9-10,18H2,1H3 |
| InChIKey | KOKORJXQOLSGGL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.89 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |