C18H22BrNS — CID 63539247
2-(3-bromophenyl)-2-(4-tert-butylphenyl)sulfanylethanamine (PubChem CID 63539247) has the molecular formula C18H22BrNS and a molecular weight of 364.35 g/mol. Its IUPAC name is 2-(3-bromophenyl)-2-(4-tert-butylphenyl)sulfanylethanamine.
| Compound Name | 2-(3-bromophenyl)-2-(4-tert-butylphenyl)sulfanylethanamine |
|---|---|
| PubChem CID | 63539247 |
| Molecular Formula | C18H22BrNS |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-(3-bromophenyl)-2-(4-tert-butylphenyl)sulfanylethanamine |
| SMILES | CC(C)(C)c1ccc(SC(CN)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C18H22BrNS/c1-18(2,3)14-7-9-16(10-8-14)21-17(12-20)13-5-4-6-15(19)11-13/h4-11,17H,12,20H2,1-3H3 |
| InChIKey | ZAYSILISIKMXRU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |