About 4-(chloromethyl)-2,6-difluoro-N,N-dipropylaniline
4-(chloromethyl)-2,6-difluoro-N,N-dipropylaniline (PubChem CID 63539614) has the molecular formula C13H18ClF2N
and a molecular weight of 261.74 g/mol. Its IUPAC name is 4-(chloromethyl)-2,6-difluoro-N,N-dipropylaniline.
Molecular Properties
| Compound Name | 4-(chloromethyl)-2,6-difluoro-N,N-dipropylaniline |
| PubChem CID | 63539614 |
| Molecular Formula | C13H18ClF2N |
| Molecular Weight | 261.74 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-(chloromethyl)-2,6-difluoro-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1c(F)cc(CCl)cc1F |
| InChI | InChI=1S/C13H18ClF2N/c1-3-5-17(6-4-2)13-11(15)7-10(9-14)8-12(13)16/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | BXCHCUIQIQLJPQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.74 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-2,6-difluoro-N,N-dipropylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-2,6-difluoro-N,N-dipropylaniline?
The IUPAC name of 4-(chloromethyl)-2,6-difluoro-N,N-dipropylaniline (CID 63539614) is 4-(chloromethyl)-2,6-difluoro-N,N-dipropylaniline.
What is the SMILES notation for 4-(chloromethyl)-2,6-difluoro-N,N-dipropylaniline?
The canonical SMILES for 4-(chloromethyl)-2,6-difluoro-N,N-dipropylaniline is CCCN(CCC)c1c(F)cc(CCl)cc1F.
What is the InChIKey of 4-(chloromethyl)-2,6-difluoro-N,N-dipropylaniline?
The InChIKey is BXCHCUIQIQLJPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClF2N/c1-3-5-17(6-4-2)13-11(15)7-10(9-14)8-12(13)16/h7-8H,3-6,9H2,1-2H3.
What are the key properties of 4-(chloromethyl)-2,6-difluoro-N,N-dipropylaniline?
4-(chloromethyl)-2,6-difluoro-N,N-dipropylaniline has a molecular weight of 261.74 g/mol, XLogP of 4.33, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-2,6-difluoro-N,N-dipropylaniline is sourced from PubChem (CID 63539614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).