About N-[4-(chloromethyl)-2,6-difluorophenyl]-N-methylcycloheptanamine
N-[4-(chloromethyl)-2,6-difluorophenyl]-N-methylcycloheptanamine (PubChem CID 63540066) has the molecular formula C15H20ClF2N
and a molecular weight of 287.78 g/mol. Its IUPAC name is N-[4-(chloromethyl)-2,6-difluorophenyl]-N-methylcycloheptanamine.
Molecular Properties
| Compound Name | N-[4-(chloromethyl)-2,6-difluorophenyl]-N-methylcycloheptanamine |
| PubChem CID | 63540066 |
| Molecular Formula | C15H20ClF2N |
| Molecular Weight | 287.78 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[4-(chloromethyl)-2,6-difluorophenyl]-N-methylcycloheptanamine |
| SMILES | CN(c1c(F)cc(CCl)cc1F)C1CCCCCC1 |
| InChI | InChI=1S/C15H20ClF2N/c1-19(12-6-4-2-3-5-7-12)15-13(17)8-11(10-16)9-14(15)18/h8-9,12H,2-7,10H2,1H3 |
| InChIKey | AFUFKWDQFUQRHU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.78 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(chloromethyl)-2,6-difluorophenyl]-N-methylcycloheptanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(chloromethyl)-2,6-difluorophenyl]-N-methylcycloheptanamine?
The IUPAC name of N-[4-(chloromethyl)-2,6-difluorophenyl]-N-methylcycloheptanamine (CID 63540066) is N-[4-(chloromethyl)-2,6-difluorophenyl]-N-methylcycloheptanamine.
What is the SMILES notation for N-[4-(chloromethyl)-2,6-difluorophenyl]-N-methylcycloheptanamine?
The canonical SMILES for N-[4-(chloromethyl)-2,6-difluorophenyl]-N-methylcycloheptanamine is CN(c1c(F)cc(CCl)cc1F)C1CCCCCC1.
What is the InChIKey of N-[4-(chloromethyl)-2,6-difluorophenyl]-N-methylcycloheptanamine?
The InChIKey is AFUFKWDQFUQRHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20ClF2N/c1-19(12-6-4-2-3-5-7-12)15-13(17)8-11(10-16)9-14(15)18/h8-9,12H,2-7,10H2,1H3.
What are the key properties of N-[4-(chloromethyl)-2,6-difluorophenyl]-N-methylcycloheptanamine?
N-[4-(chloromethyl)-2,6-difluorophenyl]-N-methylcycloheptanamine has a molecular weight of 287.78 g/mol, XLogP of 4.86, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(chloromethyl)-2,6-difluorophenyl]-N-methylcycloheptanamine is sourced from PubChem (CID 63540066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).