C17H17ClO2 — CID 63540494
(1R)-1-[3-chloro-4-(2,3-dihydro-1H-inden-5-yloxy)phenyl]ethanol (PubChem CID 63540494) has the molecular formula C17H17ClO2 and a molecular weight of 288.77 g/mol. Its IUPAC name is (1R)-1-[3-chloro-4-(2,3-dihydro-1H-inden-5-yloxy)phenyl]ethanol.
| Compound Name | (1R)-1-[3-chloro-4-(2,3-dihydro-1H-inden-5-yloxy)phenyl]ethanol |
|---|---|
| PubChem CID | 63540494 |
| Molecular Formula | C17H17ClO2 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (1R)-1-[3-chloro-4-(2,3-dihydro-1H-inden-5-yloxy)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(Oc2ccc3c(c2)CCC3)c(Cl)c1 |
| InChI | InChI=1S/C17H17ClO2/c1-11(19)13-6-8-17(16(18)10-13)20-15-7-5-12-3-2-4-14(12)9-15/h5-11,19H,2-4H2,1H3/t11-/m1/s1 |
| InChIKey | DQKKZDRSQHYGJH-LLVKDONJSA-N |
| XLogP | 4.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |