C17H14N6O2S — CID 6354123
(8R,8aR)-6-amino-2-methyl-8-(5-nitrothiophen-2-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 6354123) has the molecular formula C17H14N6O2S and a molecular weight of 366.41 g/mol. Its IUPAC name is (8R,8aR)-6-amino-2-methyl-8-(5-nitrothiophen-2-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aR)-6-amino-2-methyl-8-(5-nitrothiophen-2-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 6354123 |
| Molecular Formula | C17H14N6O2S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (8R,8aR)-6-amino-2-methyl-8-(5-nitrothiophen-2-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | CN1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@H](c3ccc([N+](=O)[O-])s3)[C@H]2C1 |
| InChI | InChI=1S/C17H14N6O2S/c1-22-5-4-10-11(6-18)16(21)17(8-19,9-20)15(12(10)7-22)13-2-3-14(26-13)23(24)25/h2-4,12,15H,5,7,21H2,1H3/t12-,15-/m0/s1 |
| InChIKey | HUFASBBJGJDBAN-WFASDCNBSA-N |
| XLogP | 2.01 |
| TPSA | 143.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|