C18H13BrCl2 — CID 63542887
2-[2-bromo-2-(2,6-dichlorophenyl)ethyl]naphthalene (PubChem CID 63542887) has the molecular formula C18H13BrCl2 and a molecular weight of 380.11 g/mol. Its IUPAC name is 2-[2-bromo-2-(2,6-dichlorophenyl)ethyl]naphthalene.
| Compound Name | 2-[2-bromo-2-(2,6-dichlorophenyl)ethyl]naphthalene |
|---|---|
| PubChem CID | 63542887 |
| Molecular Formula | C18H13BrCl2 |
| Molecular Weight | 380.11 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | 2-[2-bromo-2-(2,6-dichlorophenyl)ethyl]naphthalene |
| SMILES | Clc1cccc(Cl)c1C(Br)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H13BrCl2/c19-15(18-16(20)6-3-7-17(18)21)11-12-8-9-13-4-1-2-5-14(13)10-12/h1-10,15H,11H2 |
| InChIKey | ITOKGKLXYZXKGC-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.11 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|