C18H21BrO2 — CID 63543653
1-[2-bromo-4-(4-methoxyphenyl)butyl]-2-methoxybenzene (PubChem CID 63543653) has the molecular formula C18H21BrO2 and a molecular weight of 349.27 g/mol. Its IUPAC name is 1-[2-bromo-4-(4-methoxyphenyl)butyl]-2-methoxybenzene.
| Compound Name | 1-[2-bromo-4-(4-methoxyphenyl)butyl]-2-methoxybenzene |
|---|---|
| PubChem CID | 63543653 |
| Molecular Formula | C18H21BrO2 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 1-[2-bromo-4-(4-methoxyphenyl)butyl]-2-methoxybenzene |
| SMILES | COc1ccc(CCC(Br)Cc2ccccc2OC)cc1 |
| InChI | InChI=1S/C18H21BrO2/c1-20-17-11-8-14(9-12-17)7-10-16(19)13-15-5-3-4-6-18(15)21-2/h3-6,8-9,11-12,16H,7,10,13H2,1-2H3 |
| InChIKey | OJACMLGMUMEYTK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|