About 5-fluoro-3-(2,4,4-trimethylpentan-2-yl)-1H-benzimidazole-2-thione
5-fluoro-3-(2,4,4-trimethylpentan-2-yl)-1H-benzimidazole-2-thione (PubChem CID 63546754) has the molecular formula C15H21FN2S
and a molecular weight of 280.41 g/mol. Its IUPAC name is 5-fluoro-3-(2,4,4-trimethylpentan-2-yl)-1H-benzimidazole-2-thione.
Molecular Properties
| Compound Name | 5-fluoro-3-(2,4,4-trimethylpentan-2-yl)-1H-benzimidazole-2-thione |
| PubChem CID | 63546754 |
| Molecular Formula | C15H21FN2S |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 5-fluoro-3-(2,4,4-trimethylpentan-2-yl)-1H-benzimidazole-2-thione |
| SMILES | CC(C)(C)CC(C)(C)n1c(=S)[nH]c2ccc(F)cc21 |
| InChI | InChI=1S/C15H21FN2S/c1-14(2,3)9-15(4,5)18-12-8-10(16)6-7-11(12)17-13(18)19/h6-8H,9H2,1-5H3,(H,17,19) |
| InChIKey | UOCBUGXLUJUSBG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-3-(2,4,4-trimethylpentan-2-yl)-1H-benzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-(2,4,4-trimethylpentan-2-yl)-1H-benzimidazole-2-thione?
The IUPAC name of 5-fluoro-3-(2,4,4-trimethylpentan-2-yl)-1H-benzimidazole-2-thione (CID 63546754) is 5-fluoro-3-(2,4,4-trimethylpentan-2-yl)-1H-benzimidazole-2-thione.
What is the SMILES notation for 5-fluoro-3-(2,4,4-trimethylpentan-2-yl)-1H-benzimidazole-2-thione?
The canonical SMILES for 5-fluoro-3-(2,4,4-trimethylpentan-2-yl)-1H-benzimidazole-2-thione is CC(C)(C)CC(C)(C)n1c(=S)[nH]c2ccc(F)cc21.
What is the InChIKey of 5-fluoro-3-(2,4,4-trimethylpentan-2-yl)-1H-benzimidazole-2-thione?
The InChIKey is UOCBUGXLUJUSBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21FN2S/c1-14(2,3)9-15(4,5)18-12-8-10(16)6-7-11(12)17-13(18)19/h6-8H,9H2,1-5H3,(H,17,19).
What are the key properties of 5-fluoro-3-(2,4,4-trimethylpentan-2-yl)-1H-benzimidazole-2-thione?
5-fluoro-3-(2,4,4-trimethylpentan-2-yl)-1H-benzimidazole-2-thione has a molecular weight of 280.41 g/mol, XLogP of 5.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-(2,4,4-trimethylpentan-2-yl)-1H-benzimidazole-2-thione is sourced from PubChem (CID 63546754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).