C12H7Cl2N3S — CID 63548676
3-(2,5-dichlorophenyl)-5-thiophen-2-yl-1H-1,2,4-triazole (PubChem CID 63548676) has the molecular formula C12H7Cl2N3S and a molecular weight of 296.18 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-5-thiophen-2-yl-1H-1,2,4-triazole.
| Compound Name | 3-(2,5-dichlorophenyl)-5-thiophen-2-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 63548676 |
| Molecular Formula | C12H7Cl2N3S |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-5-thiophen-2-yl-1H-1,2,4-triazole |
| SMILES | Clc1ccc(Cl)c(-c2n[nH]c(-c3cccs3)n2)c1 |
| InChI | InChI=1S/C12H7Cl2N3S/c13-7-3-4-9(14)8(6-7)11-15-12(17-16-11)10-2-1-5-18-10/h1-6H,(H,15,16,17) |
| InChIKey | XYCPJNAEWKFKNV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |