C17H21N3 — CID 63548842
5-cyclohexyl-3-(2,3-dihydro-1H-inden-5-yl)-1H-1,2,4-triazole (PubChem CID 63548842) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 5-cyclohexyl-3-(2,3-dihydro-1H-inden-5-yl)-1H-1,2,4-triazole.
| Compound Name | 5-cyclohexyl-3-(2,3-dihydro-1H-inden-5-yl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 63548842 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 5-cyclohexyl-3-(2,3-dihydro-1H-inden-5-yl)-1H-1,2,4-triazole |
| SMILES | c1cc2c(cc1-c1n[nH]c(C3CCCCC3)n1)CCC2 |
| InChI | InChI=1S/C17H21N3/c1-2-5-13(6-3-1)16-18-17(20-19-16)15-10-9-12-7-4-8-14(12)11-15/h9-11,13H,1-8H2,(H,18,19,20) |
| InChIKey | KLDSBHCVWWNMRN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |